C15H25BN3O3 — CID 123280333
CID 123280333 (PubChem CID 123280333) has the molecular formula C15H25BN3O3 and a molecular weight of 306.19 g/mol.
| Compound Name | CID 123280333 |
|---|---|
| PubChem CID | 123280333 |
| Molecular Formula | C15H25BN3O3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cnn(CC(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H25BN3O3/c1-14(2,21)15(3,4)22-16-12-9-17-19(10-12)11-13(20)18-7-5-6-8-18/h9-10,21H,5-8,11H2,1-4H3 |
| InChIKey | OXJPINMCDOXCOU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|