C26H35Cl2F2N3O2 — CID 123280580
3-butyl-1,5-dichloro-4-(4-cyclohexyloxyphenyl)-6-[(4,4-difluoropiperidin-3-yl)methoxy]-4H-pyridazine (PubChem CID 123280580) has the molecular formula C26H35Cl2F2N3O2 and a molecular weight of 530.49 g/mol. Its IUPAC name is 3-butyl-1,5-dichloro-4-(4-cyclohexyloxyphenyl)-6-[(4,4-difluoropiperidin-3-yl)methoxy]-4H-pyridazine.
| Compound Name | 3-butyl-1,5-dichloro-4-(4-cyclohexyloxyphenyl)-6-[(4,4-difluoropiperidin-3-yl)methoxy]-4H-pyridazine |
|---|---|
| PubChem CID | 123280580 |
| Molecular Formula | C26H35Cl2F2N3O2 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 3-butyl-1,5-dichloro-4-(4-cyclohexyloxyphenyl)-6-[(4,4-difluoropiperidin-3-yl)methoxy]-4H-pyridazine |
| SMILES | CCCCC1=NN(Cl)C(OCC2CNCCC2(F)F)=C(Cl)C1c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H35Cl2F2N3O2/c1-2-3-9-22-23(18-10-12-21(13-11-18)35-20-7-5-4-6-8-20)24(27)25(33(28)32-22)34-17-19-16-31-15-14-26(19,29)30/h10-13,19-20,23,31H,2-9,14-17H2,1H3 |
| InChIKey | DUEWNOSGSRNOFR-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|