C12H25N2+ — CID 123280814
3-hexyl-1,1,5-trimethyl-2H-imidazol-1-ium (PubChem CID 123280814) has the molecular formula C12H25N2+ and a molecular weight of 197.35 g/mol. Its IUPAC name is 3-hexyl-1,1,5-trimethyl-2H-imidazol-1-ium.
| Compound Name | 3-hexyl-1,1,5-trimethyl-2H-imidazol-1-ium |
|---|---|
| PubChem CID | 123280814 |
| Molecular Formula | C12H25N2+ |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | 3-hexyl-1,1,5-trimethyl-2H-imidazol-1-ium |
| SMILES | CCCCCCN1C=C(C)[N+](C)(C)C1 |
| InChI | InChI=1S/C12H25N2/c1-5-6-7-8-9-13-10-12(2)14(3,4)11-13/h10H,5-9,11H2,1-4H3/q+1 |
| InChIKey | PSDHNOPWSIMKKF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|