C26H25F7O3S — CID 123280867
6-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione (PubChem CID 123280867) has the molecular formula C26H25F7O3S and a molecular weight of 550.54 g/mol. Its IUPAC name is 6-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione.
| Compound Name | 6-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 123280867 |
| Molecular Formula | C26H25F7O3S |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 6-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C(C)CSc3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C26H25F7O3S/c1-13-9-14(2)21(15(3)10-13)22-19(34)11-20(36-23(22)35)16(4)12-37-18-7-5-17(6-8-18)24(27,25(28,29)30)26(31,32)33/h5-10,16,20,22H,11-12H2,1-4H3 |
| InChIKey | UNSWUHNSONLDLD-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|