C9H21N3Si3 — CID 123281634
1,2,2-tris(ethenyl)-3,4,4-trimethyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 123281634) has the molecular formula C9H21N3Si3 and a molecular weight of 255.55 g/mol. Its IUPAC name is 1,2,2-tris(ethenyl)-3,4,4-trimethyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 1,2,2-tris(ethenyl)-3,4,4-trimethyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 123281634 |
| Molecular Formula | C9H21N3Si3 |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1,2,2-tris(ethenyl)-3,4,4-trimethyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | C=CN1[SiH2]N[Si](C)(C)N(C)[Si]1(C=C)C=C |
| InChI | InChI=1S/C9H21N3Si3/c1-7-12-13-10-14(5,6)11(4)15(12,8-2)9-3/h7-10H,1-3,13H2,4-6H3 |
| InChIKey | FPCMTWWOFGEZHA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|