About N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine
N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine (PubChem CID 123282786) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine.
Molecular Properties
| Compound Name | N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine |
| PubChem CID | 123282786 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine |
| SMILES | C=C(CCNCC)C(C)C(C)C=CC |
| InChI | InChI=1S/C13H25N/c1-6-8-11(3)13(5)12(4)9-10-14-7-2/h6,8,11,13-14H,4,7,9-10H2,1-3,5H3 |
| InChIKey | MWHSVVVAYFLIOB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine?
The IUPAC name of N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine (CID 123282786) is N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine.
What is the SMILES notation for N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine?
The canonical SMILES for N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine is C=C(CCNCC)C(C)C(C)C=CC.
What is the InChIKey of N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine?
The InChIKey is MWHSVVVAYFLIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-6-8-11(3)13(5)12(4)9-10-14-7-2/h6,8,11,13-14H,4,7,9-10H2,1-3,5H3.
What are the key properties of N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine?
N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine has a molecular weight of 195.35 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,5-dimethyl-3-methylideneoct-6-en-1-amine is sourced from PubChem (CID 123282786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).