About CID 123282790
CID 123282790 (PubChem CID 123282790) has the molecular formula C27H29BN3O3
and a molecular weight of 454.36 g/mol.
Molecular Properties
| Compound Name | CID 123282790 |
| PubChem CID | 123282790 |
| Molecular Formula | C27H29BN3O3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | — |
| SMILES | COCC1CNC(c2nc3c(ccc4cc5c(cc43)OCc3cc([B]OC(C)C)ccc3-5)[nH]2)C1 |
| InChI | InChI=1S/C27H29BN3O3/c1-15(2)34-28-19-5-6-20-18(9-19)14-33-25-11-21-17(10-22(20)25)4-7-23-26(21)31-27(30-23)24-8-16(12-29-24)13-32-3/h4-7,9-11,15-16,24,29H,8,12-14H2,1-3H3,(H,30,31) |
| InChIKey | HGAQHHCZHZTILX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123282790 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123282790?
The IUPAC name of CID 123282790 (CID 123282790) is not available.
What is the SMILES notation for CID 123282790?
The canonical SMILES for CID 123282790 is COCC1CNC(c2nc3c(ccc4cc5c(cc43)OCc3cc([B]OC(C)C)ccc3-5)[nH]2)C1.
What is the InChIKey of CID 123282790?
The InChIKey is HGAQHHCZHZTILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29BN3O3/c1-15(2)34-28-19-5-6-20-18(9-19)14-33-25-11-21-17(10-22(20)25)4-7-23-26(21)31-27(30-23)24-8-16(12-29-24)13-32-3/h4-7,9-11,15-16,24,29H,8,12-14H2,1-3H3,(H,30,31).
What are the key properties of CID 123282790?
CID 123282790 has a molecular weight of 454.36 g/mol, XLogP of 4.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123282790 is sourced from PubChem (CID 123282790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).