C29H38N4O2 — CID 123282954
methyl 3-cyano-N-[1-[1-[2-(diethylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate (PubChem CID 123282954) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is methyl 3-cyano-N-[1-[1-[2-(diethylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate.
| Compound Name | methyl 3-cyano-N-[1-[1-[2-(diethylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
|---|---|
| PubChem CID | 123282954 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | methyl 3-cyano-N-[1-[1-[2-(diethylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2NCCN(CC)CC |
| InChI | InChI=1S/C29H38N4O2/c1-7-33(8-2)17-16-31-27-14-13-25-24(10-9-11-26(25)27)21(5)32-29(34-6)22-12-15-28(35-20(3)4)23(18-22)19-30/h9-12,15,18,20,27,31H,5,7-8,13-14,16-17H2,1-4,6H3/b32-29- |
| InChIKey | DAYYUWPGDQLFCL-OVXWJCGASA-N |
| XLogP | 5.33 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|