C22H37BN2O4 — CID 123283129
tert-butyl 7-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]heptanoate (PubChem CID 123283129) has the molecular formula C22H37BN2O4 and a molecular weight of 404.36 g/mol. Its IUPAC name is tert-butyl 7-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]heptanoate |
|---|---|
| PubChem CID | 123283129 |
| Molecular Formula | C22H37BN2O4 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | tert-butyl 7-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCNc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C22H37BN2O4/c1-20(2,3)27-19(26)12-10-8-9-11-15-24-18-14-13-17(16-25-18)23-28-21(4,5)22(6,7)29-23/h13-14,16H,8-12,15H2,1-7H3,(H,24,25) |
| InChIKey | HGFWCZKTKGKSMT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|