C32H49N7O — CID 123283434
5-(3-diazenyl-5-iminopentan-2-yl)-N-[2-[2-[5-[3-ethyl-5-(methoxymethyl)-2-pyridinyl]cyclononyl]cyclopropyl]ethyl]pyrimidin-2-amine (PubChem CID 123283434) has the molecular formula C32H49N7O and a molecular weight of 547.79 g/mol. Its IUPAC name is 5-(3-diazenyl-5-iminopentan-2-yl)-N-[2-[2-[5-[3-ethyl-5-(methoxymethyl)-2-pyridinyl]cyclononyl]cyclopropyl]ethyl]pyrimidin-2-amine.
| Compound Name | 5-(3-diazenyl-5-iminopentan-2-yl)-N-[2-[2-[5-[3-ethyl-5-(methoxymethyl)-2-pyridinyl]cyclononyl]cyclopropyl]ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123283434 |
| Molecular Formula | C32H49N7O |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.40 |
| IUPAC Name | 5-(3-diazenyl-5-iminopentan-2-yl)-N-[2-[2-[5-[3-ethyl-5-(methoxymethyl)-2-pyridinyl]cyclononyl]cyclopropyl]ethyl]pyrimidin-2-amine |
| SMILES | [H]/N=C/CC(/N=N/[H])C(C)c1cnc(NCCC2CC2C2CCCCC(c3ncc(COC)cc3CC)CCC2)nc1 |
| InChI | InChI=1S/C32H49N7O/c1-4-24-16-23(21-40-3)18-36-31(24)26-9-6-5-8-25(10-7-11-26)29-17-27(29)13-15-35-32-37-19-28(20-38-32)22(2)30(39-34)12-14-33/h14,16,18-20,22,25-27,29-30,33-34H,4-13,15,17,21H2,1-3H3,(H,35,37,38)/b33-14+,39-34+ |
| InChIKey | NVJCJZAPAVNEFK-CGNQRPCSSA-N |
| XLogP | 7.71 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|