C21H44N4O — CID 123283888
1,2,3,6-tetramethyl-5-[3-(3,4,5,6-tetramethylpiperazin-2-yl)butan-2-yloxymethyl]piperazine (PubChem CID 123283888) has the molecular formula C21H44N4O and a molecular weight of 368.61 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-5-[3-(3,4,5,6-tetramethylpiperazin-2-yl)butan-2-yloxymethyl]piperazine.
| Compound Name | 1,2,3,6-tetramethyl-5-[3-(3,4,5,6-tetramethylpiperazin-2-yl)butan-2-yloxymethyl]piperazine |
|---|---|
| PubChem CID | 123283888 |
| Molecular Formula | C21H44N4O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.35 |
| IUPAC Name | 1,2,3,6-tetramethyl-5-[3-(3,4,5,6-tetramethylpiperazin-2-yl)butan-2-yloxymethyl]piperazine |
| SMILES | CC1NC(COC(C)C(C)C2NC(C)C(C)N(C)C2C)C(C)N(C)C1C |
| InChI | InChI=1S/C21H44N4O/c1-12(21-18(7)25(10)16(5)14(3)23-21)19(8)26-11-20-17(6)24(9)15(4)13(2)22-20/h12-23H,11H2,1-10H3 |
| InChIKey | MTQAORRWMUMPIW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |