About 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine
2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine (PubChem CID 123284441) has the molecular formula C14H24F2N2
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine |
| PubChem CID | 123284441 |
| Molecular Formula | C14H24F2N2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine |
| SMILES | CC=C(/C=N/CC)C(CN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H24F2N2/c1-3-11(10-18-4-2)13(9-17)12-5-7-14(15,16)8-6-12/h3,10,12-13H,4-9,17H2,1-2H3/b11-3?,18-10+ |
| InChIKey | JMPARPRNPDWVBS-OLRKNTPDSA-N |
| XLogP | 3.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine?
The IUPAC name of 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine (CID 123284441) is 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine is CC=C(/C=N/CC)C(CN)C1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine?
The InChIKey is JMPARPRNPDWVBS-OLRKNTPDSA-N. The full InChI is InChI=1S/C14H24F2N2/c1-3-11(10-18-4-2)13(9-17)12-5-7-14(15,16)8-6-12/h3,10,12-13H,4-9,17H2,1-2H3/b11-3?,18-10+.
What are the key properties of 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine?
2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine has a molecular weight of 258.36 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)-3-(ethyliminomethyl)pent-3-en-1-amine is sourced from PubChem (CID 123284441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).