C17H14F5N3O2S — CID 123284599
8a-(2,4-difluorophenyl)-6-[4-(trifluoromethyl)-1,3-oxazol-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 123284599) has the molecular formula C17H14F5N3O2S and a molecular weight of 419.38 g/mol. Its IUPAC name is 8a-(2,4-difluorophenyl)-6-[4-(trifluoromethyl)-1,3-oxazol-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | 8a-(2,4-difluorophenyl)-6-[4-(trifluoromethyl)-1,3-oxazol-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 123284599 |
| Molecular Formula | C17H14F5N3O2S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 8a-(2,4-difluorophenyl)-6-[4-(trifluoromethyl)-1,3-oxazol-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=NC2(c3ccc(F)cc3F)COC(c3nc(C(F)(F)F)co3)CC2CS1 |
| InChI | InChI=1S/C17H14F5N3O2S/c18-9-1-2-10(11(19)4-9)16-7-27-12(3-8(16)6-28-15(23)25-16)14-24-13(5-26-14)17(20,21)22/h1-2,4-5,8,12H,3,6-7H2,(H2,23,25) |
| InChIKey | UBFYFJQJWNNVJD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |