C25H22F6O5S2 — CID 123285365
[1,1,1,3,3-pentafluoro-3-[[(4-fluorophenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]propan-2-yl] 2-methylprop-2-enoate (PubChem CID 123285365) has the molecular formula C25H22F6O5S2 and a molecular weight of 580.57 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-[[(4-fluorophenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-[[(4-fluorophenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123285365 |
| Molecular Formula | C25H22F6O5S2 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-[[(4-fluorophenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22F6O5S2/c1-17(2)22(32)36-23(24(27,28)29)25(30,31)38(33,34,35)37(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-15-13-18(26)14-16-21/h3-16,23H,1H2,2H3,(H2,33,34,35) |
| InChIKey | AXPXBTYCAWSYKO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|