C26H31N3O2S — CID 123285399
3-(2,3-dimethyl-1-propylindol-5-yl)-5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione (PubChem CID 123285399) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-(2,3-dimethyl-1-propylindol-5-yl)-5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2,3-dimethyl-1-propylindol-5-yl)-5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 123285399 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-(2,3-dimethyl-1-propylindol-5-yl)-5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione |
| SMILES | CCCn1c(C)c(C)c2cc(-n3c(-c4cc(CC)c(O)cc4O)c(CC)[nH]c3=S)ccc21 |
| InChI | InChI=1S/C26H31N3O2S/c1-6-11-28-16(5)15(4)19-13-18(9-10-22(19)28)29-25(21(8-3)27-26(29)32)20-12-17(7-2)23(30)14-24(20)31/h9-10,12-14,30-31H,6-8,11H2,1-5H3,(H,27,32) |
| InChIKey | GGBKPCDPTWUJSZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|