C28H27NS4 — CID 123286028
4-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-2,5-dimethylhex-3-en-2-amine (PubChem CID 123286028) has the molecular formula C28H27NS4 and a molecular weight of 505.80 g/mol. Its IUPAC name is 4-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-2,5-dimethylhex-3-en-2-amine.
| Compound Name | 4-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-2,5-dimethylhex-3-en-2-amine |
|---|---|
| PubChem CID | 123286028 |
| Molecular Formula | C28H27NS4 |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-2,5-dimethylhex-3-en-2-amine |
| SMILES | CC(C)C(=CC(C)(C)N)c1ccc2c(=C3SC=CS3)c3ccccc3c(=C3SC=CS3)c2c1 |
| InChI | InChI=1S/C28H27NS4/c1-17(2)23(16-28(3,4)29)18-9-10-21-22(15-18)25(27-32-13-14-33-27)20-8-6-5-7-19(20)24(21)26-30-11-12-31-26/h5-17H,29H2,1-4H3 |
| InChIKey | BTNYGAVTVAANSS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|