C26H16N2S — CID 123287178
3-dibenzothiophen-4-yl-6-isocyano-9-methylcarbazole (PubChem CID 123287178) has the molecular formula C26H16N2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 3-dibenzothiophen-4-yl-6-isocyano-9-methylcarbazole.
| Compound Name | 3-dibenzothiophen-4-yl-6-isocyano-9-methylcarbazole |
|---|---|
| PubChem CID | 123287178 |
| Molecular Formula | C26H16N2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-dibenzothiophen-4-yl-6-isocyano-9-methylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3cccc4c3sc3ccccc34)ccc1n2C |
| InChI | InChI=1S/C26H16N2S/c1-27-17-11-13-24-22(15-17)21-14-16(10-12-23(21)28(24)2)18-7-5-8-20-19-6-3-4-9-25(19)29-26(18)20/h3-15H,2H3 |
| InChIKey | YHHWISZBLVIFPJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|