C16H25N — CID 123287385
(2E,4Z)-3,7-ditert-butylcycloocta-2,4,7-trien-1-imine (PubChem CID 123287385) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (2E,4Z)-3,7-ditert-butylcycloocta-2,4,7-trien-1-imine.
| Compound Name | (2E,4Z)-3,7-ditert-butylcycloocta-2,4,7-trien-1-imine |
|---|---|
| PubChem CID | 123287385 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (2E,4Z)-3,7-ditert-butylcycloocta-2,4,7-trien-1-imine |
| SMILES | [H]/N=C1C=C(C(C)(C)C)C/C=C/C(C(C)(C)C)=C\1 |
| InChI | InChI=1S/C16H25N/c1-15(2,3)12-8-7-9-13(16(4,5)6)11-14(17)10-12/h7-8,10-11,17H,9H2,1-6H3/b8-7-,12-10+,13-11?,17-14- |
| InChIKey | BDFSVHFHGNGMBK-CPYHGKPFSA-N |
| XLogP | 4.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|