About 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole
1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole (PubChem CID 123287760) has the molecular formula C8H6FNO
and a molecular weight of 151.14 g/mol. Its IUPAC name is 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole.
Molecular Properties
| Compound Name | 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole |
| PubChem CID | 123287760 |
| Molecular Formula | C8H6FNO |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole |
| SMILES | FC1C2Oc3ccccc3N12 |
| InChI | InChI=1S/C8H6FNO/c9-7-8-10(7)5-3-1-2-4-6(5)11-8/h1-4,7-8H |
| InChIKey | SYAFZYVPOZRLKT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole?
The IUPAC name of 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole (CID 123287760) is 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole.
What is the SMILES notation for 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole?
The canonical SMILES for 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole is FC1C2Oc3ccccc3N12.
What is the InChIKey of 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole?
The InChIKey is SYAFZYVPOZRLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO/c9-7-8-10(7)5-3-1-2-4-6(5)11-8/h1-4,7-8H.
What are the key properties of 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole?
1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole has a molecular weight of 151.14 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole is sourced from PubChem (CID 123287760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).