C24H47N — CID 123288171
5-ethyl-N,2,6,6-tetramethyl-N-[2-[3-(2-methylbutyl)cyclobutyl]ethyl]hept-2-en-1-amine (PubChem CID 123288171) has the molecular formula C24H47N and a molecular weight of 349.65 g/mol. Its IUPAC name is 5-ethyl-N,2,6,6-tetramethyl-N-[2-[3-(2-methylbutyl)cyclobutyl]ethyl]hept-2-en-1-amine.
| Compound Name | 5-ethyl-N,2,6,6-tetramethyl-N-[2-[3-(2-methylbutyl)cyclobutyl]ethyl]hept-2-en-1-amine |
|---|---|
| PubChem CID | 123288171 |
| Molecular Formula | C24H47N |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 349.37 |
| IUPAC Name | 5-ethyl-N,2,6,6-tetramethyl-N-[2-[3-(2-methylbutyl)cyclobutyl]ethyl]hept-2-en-1-amine |
| SMILES | CCC(C)CC1CC(CCN(C)CC(C)=CCC(CC)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H47N/c1-9-19(3)15-22-16-21(17-22)13-14-25(8)18-20(4)11-12-23(10-2)24(5,6)7/h11,19,21-23H,9-10,12-18H2,1-8H3 |
| InChIKey | DWZRWQOBRMTBSJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|