About 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine
5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine (PubChem CID 123288350) has the molecular formula C3H4N3O2S+
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine.
Molecular Properties
| Compound Name | 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine |
| PubChem CID | 123288350 |
| Molecular Formula | C3H4N3O2S+ |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine |
| SMILES | NC1N[C+]=C([N+](=O)[O-])S1 |
| InChI | InChI=1S/C3H4N3O2S/c4-3-5-1-2(9-3)6(7)8/h3,5H,4H2/q+1 |
| InChIKey | AJMBIKMMRTYVIQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine?
The IUPAC name of 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine (CID 123288350) is 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine.
What is the SMILES notation for 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine?
The canonical SMILES for 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine is NC1N[C+]=C([N+](=O)[O-])S1.
What is the InChIKey of 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine?
The InChIKey is AJMBIKMMRTYVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N3O2S/c4-3-5-1-2(9-3)6(7)8/h3,5H,4H2/q+1.
What are the key properties of 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine?
5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine has a molecular weight of 146.15 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-3,4-dihydro-2H-1,3-thiazol-4-ylium-2-amine is sourced from PubChem (CID 123288350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).