C21H42FNO2 — CID 123288875
2-amino-2-(8-ethylidene-16-fluorohexadecyl)propane-1,3-diol (PubChem CID 123288875) has the molecular formula C21H42FNO2 and a molecular weight of 359.57 g/mol. Its IUPAC name is 2-amino-2-(8-ethylidene-16-fluorohexadecyl)propane-1,3-diol.
| Compound Name | 2-amino-2-(8-ethylidene-16-fluorohexadecyl)propane-1,3-diol |
|---|---|
| PubChem CID | 123288875 |
| Molecular Formula | C21H42FNO2 |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 2-amino-2-(8-ethylidene-16-fluorohexadecyl)propane-1,3-diol |
| SMILES | CC=C(CCCCCCCCF)CCCCCCCC(N)(CO)CO |
| InChI | InChI=1S/C21H42FNO2/c1-2-20(14-10-6-3-4-9-13-17-22)15-11-7-5-8-12-16-21(23,18-24)19-25/h2,24-25H,3-19,23H2,1H3 |
| InChIKey | ZTVUIPOTRMPSCD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|