C30H35NO9 — CID 123288941
10-(4-amino-6-methyloxan-2-yl)oxy-6,11-dihydroxy-1-methoxy-8-(2-propan-2-yloxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 123288941) has the molecular formula C30H35NO9 and a molecular weight of 553.61 g/mol. Its IUPAC name is 10-(4-amino-6-methyloxan-2-yl)oxy-6,11-dihydroxy-1-methoxy-8-(2-propan-2-yloxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | 10-(4-amino-6-methyloxan-2-yl)oxy-6,11-dihydroxy-1-methoxy-8-(2-propan-2-yloxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 123288941 |
| Molecular Formula | C30H35NO9 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 10-(4-amino-6-methyloxan-2-yl)oxy-6,11-dihydroxy-1-methoxy-8-(2-propan-2-yloxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C(=O)COC(C)C)CC3OC1CC(N)CC(C)O1 |
| InChI | InChI=1S/C30H35NO9/c1-13(2)38-12-19(32)15-9-18-24(21(10-15)40-22-11-16(31)8-14(3)39-22)30(36)26-25(28(18)34)27(33)17-6-5-7-20(37-4)23(17)29(26)35/h5-7,13-16,21-22,34,36H,8-12,31H2,1-4H3 |
| InChIKey | IDBUAPYMZRRTBE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|