C7H9F2N3O6S — CID 123289047
(2-carbamoyl-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 123289047) has the molecular formula C7H9F2N3O6S and a molecular weight of 301.23 g/mol. Its IUPAC name is (2-carbamoyl-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | (2-carbamoyl-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 123289047 |
| Molecular Formula | C7H9F2N3O6S |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (2-carbamoyl-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | NC(=O)C1CC(F)(F)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H9F2N3O6S/c8-7(9)1-3(5(10)13)11-2-4(7)12(6(11)14)18-19(15,16)17/h3-4H,1-2H2,(H2,10,13)(H,15,16,17) |
| InChIKey | QJXAFUMXSOKKEO-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|