About dimethylsilyl 4-methylpentanoate
dimethylsilyl 4-methylpentanoate (PubChem CID 123289315) has the molecular formula C8H18O2Si
and a molecular weight of 174.32 g/mol. Its IUPAC name is dimethylsilyl 4-methylpentanoate.
Molecular Properties
| Compound Name | dimethylsilyl 4-methylpentanoate |
| PubChem CID | 123289315 |
| Molecular Formula | C8H18O2Si |
| Molecular Weight | 174.32 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | dimethylsilyl 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[SiH](C)C |
| InChI | InChI=1S/C8H18O2Si/c1-7(2)5-6-8(9)10-11(3)4/h7,11H,5-6H2,1-4H3 |
| InChIKey | XBOFKMNSYHNMFX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilyl 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilyl 4-methylpentanoate?
The IUPAC name of dimethylsilyl 4-methylpentanoate (CID 123289315) is dimethylsilyl 4-methylpentanoate.
What is the SMILES notation for dimethylsilyl 4-methylpentanoate?
The canonical SMILES for dimethylsilyl 4-methylpentanoate is CC(C)CCC(=O)O[SiH](C)C.
What is the InChIKey of dimethylsilyl 4-methylpentanoate?
The InChIKey is XBOFKMNSYHNMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2Si/c1-7(2)5-6-8(9)10-11(3)4/h7,11H,5-6H2,1-4H3.
What are the key properties of dimethylsilyl 4-methylpentanoate?
dimethylsilyl 4-methylpentanoate has a molecular weight of 174.32 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilyl 4-methylpentanoate is sourced from PubChem (CID 123289315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).