About [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate
[2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate (PubChem CID 123290050) has the molecular formula C10H11Cl3O8
and a molecular weight of 365.55 g/mol. Its IUPAC name is [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate.
Molecular Properties
| Compound Name | [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate |
| PubChem CID | 123290050 |
| Molecular Formula | C10H11Cl3O8 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate |
| SMILES | O=C(Cl)OC1CC(OCO)C(OC(=O)Cl)C(OC(=O)Cl)C1 |
| InChI | InChI=1S/C10H11Cl3O8/c11-8(15)19-4-1-5(18-3-14)7(21-10(13)17)6(2-4)20-9(12)16/h4-7,14H,1-3H2 |
| InChIKey | OBWNMYQKIZUXLP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate?
The IUPAC name of [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate (CID 123290050) is [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate.
What is the SMILES notation for [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate?
The canonical SMILES for [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate is O=C(Cl)OC1CC(OCO)C(OC(=O)Cl)C(OC(=O)Cl)C1.
What is the InChIKey of [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate?
The InChIKey is OBWNMYQKIZUXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl3O8/c11-8(15)19-4-1-5(18-3-14)7(21-10(13)17)6(2-4)20-9(12)16/h4-7,14H,1-3H2.
What are the key properties of [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate?
[2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate has a molecular weight of 365.55 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dicarbonochloridoyloxy-6-(hydroxymethoxy)cyclohexyl] carbonochloridate is sourced from PubChem (CID 123290050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).