C22H22F2N2O3S — CID 123290065
2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-pyridin-2-ylprop-2-enamide (PubChem CID 123290065) has the molecular formula C22H22F2N2O3S and a molecular weight of 432.49 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-pyridin-2-ylprop-2-enamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 123290065 |
| Molecular Formula | C22H22F2N2O3S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-pyridin-2-ylprop-2-enamide |
| SMILES | O=C(Nc1ccccn1)C(=CC1C[C@@H](F)[C@@H](F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H22F2N2O3S/c23-19-12-14(13-20(19)24)11-18(22(27)26-21-3-1-2-10-25-21)15-4-6-16(7-5-15)30(28,29)17-8-9-17/h1-7,10-11,14,17,19-20H,8-9,12-13H2,(H,25,26,27)/t14?,19-,20+ |
| InChIKey | DRJGKLMVJXIFRQ-DIJDEUIISA-N |
| XLogP | 4.13 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|