About 1,5-dimethylcyclohexa-1,2-diene
1,5-dimethylcyclohexa-1,2-diene (PubChem CID 123290663) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is 1,5-dimethylcyclohexa-1,2-diene.
Molecular Properties
| Compound Name | 1,5-dimethylcyclohexa-1,2-diene |
| PubChem CID | 123290663 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 1,5-dimethylcyclohexa-1,2-diene |
| SMILES | CC1=C=CCC(C)C1 |
| InChI | InChI=1S/C8H12/c1-7-4-3-5-8(2)6-7/h3,7H,4,6H2,1-2H3 |
| InChIKey | WMJDFRQCNQKUSD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-dimethylcyclohexa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylcyclohexa-1,2-diene?
The IUPAC name of 1,5-dimethylcyclohexa-1,2-diene (CID 123290663) is 1,5-dimethylcyclohexa-1,2-diene.
What is the SMILES notation for 1,5-dimethylcyclohexa-1,2-diene?
The canonical SMILES for 1,5-dimethylcyclohexa-1,2-diene is CC1=C=CCC(C)C1.
What is the InChIKey of 1,5-dimethylcyclohexa-1,2-diene?
The InChIKey is WMJDFRQCNQKUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12/c1-7-4-3-5-8(2)6-7/h3,7H,4,6H2,1-2H3.
What are the key properties of 1,5-dimethylcyclohexa-1,2-diene?
1,5-dimethylcyclohexa-1,2-diene has a molecular weight of 108.18 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylcyclohexa-1,2-diene is sourced from PubChem (CID 123290663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).