C4H6F2N2O — CID 123290716
3,3-difluoroazetidine-1-carboxamide (PubChem CID 123290716) has the molecular formula C4H6F2N2O and a molecular weight of 136.10 g/mol. Its IUPAC name is 3,3-difluoroazetidine-1-carboxamide.
| Compound Name | 3,3-difluoroazetidine-1-carboxamide |
|---|---|
| PubChem CID | 123290716 |
| Molecular Formula | C4H6F2N2O |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3,3-difluoroazetidine-1-carboxamide |
| SMILES | NC(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C4H6F2N2O/c5-4(6)1-8(2-4)3(7)9/h1-2H2,(H2,7,9) |
| InChIKey | SBBKNQZYXLPIDK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |