C20H41N3+2 — CID 123290821
1,4-dimethyl-2-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]-1,3-di(propan-2-yl)triazete-1,3-diium (PubChem CID 123290821) has the molecular formula C20H41N3+2 and a molecular weight of 323.57 g/mol. Its IUPAC name is 1,4-dimethyl-2-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]-1,3-di(propan-2-yl)triazete-1,3-diium.
| Compound Name | 1,4-dimethyl-2-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]-1,3-di(propan-2-yl)triazete-1,3-diium |
|---|---|
| PubChem CID | 123290821 |
| Molecular Formula | C20H41N3+2 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.33 |
| IUPAC Name | 1,4-dimethyl-2-[(1,2,3,4,5-pentamethylcyclopentyl)methyl]-1,3-di(propan-2-yl)triazete-1,3-diium |
| SMILES | CC1=[N+](C(C)C)N(CC2(C)C(C)C(C)C(C)C2C)[N+]1(C)C(C)C |
| InChI | InChI=1S/C20H41N3/c1-13(2)22-19(9)23(11,14(3)4)21(22)12-20(10)17(7)15(5)16(6)18(20)8/h13-18H,12H2,1-11H3/q+2 |
| InChIKey | WJERMBVRIKBWCS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|