About butyl tetradec-6-enoate
butyl tetradec-6-enoate (PubChem CID 123290881) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is butyl tetradec-6-enoate.
Molecular Properties
| Compound Name | butyl tetradec-6-enoate |
| PubChem CID | 123290881 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | butyl tetradec-6-enoate |
| SMILES | CCCCCCCC=CCCCCC(=O)OCCCC |
| InChI | InChI=1S/C18H34O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h11-12H,3-10,13-17H2,1-2H3 |
| InChIKey | PHRBARKJMMDXSR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl tetradec-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl tetradec-6-enoate?
The IUPAC name of butyl tetradec-6-enoate (CID 123290881) is butyl tetradec-6-enoate.
What is the SMILES notation for butyl tetradec-6-enoate?
The canonical SMILES for butyl tetradec-6-enoate is CCCCCCCC=CCCCCC(=O)OCCCC.
What is the InChIKey of butyl tetradec-6-enoate?
The InChIKey is PHRBARKJMMDXSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h11-12H,3-10,13-17H2,1-2H3.
What are the key properties of butyl tetradec-6-enoate?
butyl tetradec-6-enoate has a molecular weight of 282.47 g/mol, XLogP of 5.81, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl tetradec-6-enoate is sourced from PubChem (CID 123290881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).