C33H39N3 — CID 123291058
2,4,5,7,9,10,12,14,15,17,19,20-dodecamethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8,10,12,14,16(22),17,19-undecaene (PubChem CID 123291058) has the molecular formula C33H39N3 and a molecular weight of 477.70 g/mol. Its IUPAC name is 2,4,5,7,9,10,12,14,15,17,19,20-dodecamethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8,10,12,14,16(22),17,19-undecaene.
| Compound Name | 2,4,5,7,9,10,12,14,15,17,19,20-dodecamethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8,10,12,14,16(22),17,19-undecaene |
|---|---|
| PubChem CID | 123291058 |
| Molecular Formula | C33H39N3 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 2,4,5,7,9,10,12,14,15,17,19,20-dodecamethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8,10,12,14,16(22),17,19-undecaene |
| SMILES | CC1=C(C)/C2=C(\C)C3=N/C(=C(/C)c4[nH]c(c(C)c4C)/C(C)=C4\C/C(=C(/C)C1=N2)C(C)=C4C)C(C)=C3C |
| InChI | InChI=1S/C33H39N3/c1-14-15(2)27-13-26(14)22(9)28-16(3)18(5)30(34-28)24(11)32-20(7)21(8)33(36-32)25(12)31-19(6)17(4)29(35-31)23(27)10/h34H,13H2,1-12H3/b26-22+,27-23+,28-22-,29-23-,30-24-,31-25-,32-24-,33-25- |
| InChIKey | XFPGYHLPJAZLPF-RNUZDLCISA-N |
| XLogP | 9.06 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |