About 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine
5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine (PubChem CID 123291529) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine |
| PubChem CID | 123291529 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine |
| SMILES | CCC(C)OC(C)CC(C)(CC)N(C)CC |
| InChI | InChI=1S/C14H31NO/c1-8-12(4)16-13(5)11-14(6,9-2)15(7)10-3/h12-13H,8-11H2,1-7H3 |
| InChIKey | VSPXRFTXQGYRJS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine?
The IUPAC name of 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine (CID 123291529) is 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine.
What is the SMILES notation for 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine?
The canonical SMILES for 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine is CCC(C)OC(C)CC(C)(CC)N(C)CC.
What is the InChIKey of 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine?
The InChIKey is VSPXRFTXQGYRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO/c1-8-12(4)16-13(5)11-14(6,9-2)15(7)10-3/h12-13H,8-11H2,1-7H3.
What are the key properties of 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine?
5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine has a molecular weight of 229.41 g/mol, XLogP of 3.70, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yloxy-N-ethyl-N,3-dimethylhexan-3-amine is sourced from PubChem (CID 123291529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).