About 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene
5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene (PubChem CID 123291649) has the molecular formula C9H11BrF2
and a molecular weight of 237.09 g/mol. Its IUPAC name is 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene.
Molecular Properties
| Compound Name | 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene |
| PubChem CID | 123291649 |
| Molecular Formula | C9H11BrF2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)C(=CC(Br)=CC)C(F)F |
| InChI | InChI=1S/C9H11BrF2/c1-4-7(10)5-8(6(2)3)9(11)12/h4-5,9H,2H2,1,3H3 |
| InChIKey | XAEVJYOEHRHWPR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene?
The IUPAC name of 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene (CID 123291649) is 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene.
What is the SMILES notation for 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene?
The canonical SMILES for 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene is C=C(C)C(=CC(Br)=CC)C(F)F.
What is the InChIKey of 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene?
The InChIKey is XAEVJYOEHRHWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrF2/c1-4-7(10)5-8(6(2)3)9(11)12/h4-5,9H,2H2,1,3H3.
What are the key properties of 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene?
5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene has a molecular weight of 237.09 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene is sourced from PubChem (CID 123291649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).