C29H36F3N5S — CID 123291680
ethenyl N-[1-[2-[[2-[[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]ethenyl]ethanimidothioate (PubChem CID 123291680) has the molecular formula C29H36F3N5S and a molecular weight of 543.70 g/mol. Its IUPAC name is ethenyl N-[1-[2-[[2-[[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]ethenyl]ethanimidothioate.
| Compound Name | ethenyl N-[1-[2-[[2-[[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]ethenyl]ethanimidothioate |
|---|---|
| PubChem CID | 123291680 |
| Molecular Formula | C29H36F3N5S |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | ethenyl N-[1-[2-[[2-[[1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]amino]cyclohexyl]amino]-4-pyridinyl]ethenyl]ethanimidothioate |
| SMILES | C=CS/C(C)=N/C(=C)c1ccnc(NC2CCCCC2NC2CCCN(c3ccc(C(F)(F)F)cc3)C2)c1 |
| InChI | InChI=1S/C29H36F3N5S/c1-4-38-21(3)34-20(2)22-15-16-33-28(18-22)36-27-10-6-5-9-26(27)35-24-8-7-17-37(19-24)25-13-11-23(12-14-25)29(30,31)32/h4,11-16,18,24,26-27,35H,1-2,5-10,17,19H2,3H3,(H,33,36)/b34-21+ |
| InChIKey | PPJTWOZRUCYREA-KEIPNQJHSA-N |
| XLogP | 7.35 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|