C21H19F2N9 — CID 123292046
2-[1-[(2,3-difluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethylpyrrolo[2,3-d]pyrimidine-4,6-diamine (PubChem CID 123292046) has the molecular formula C21H19F2N9 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-[1-[(2,3-difluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethylpyrrolo[2,3-d]pyrimidine-4,6-diamine.
| Compound Name | 2-[1-[(2,3-difluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethylpyrrolo[2,3-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 123292046 |
| Molecular Formula | C21H19F2N9 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[1-[(2,3-difluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethylpyrrolo[2,3-d]pyrimidine-4,6-diamine |
| SMILES | Cc1ncc2c(-c3nc(N)c4c(n3)N=C(N)C4(C)C)nn(Cc3cccc(F)c3F)c2n1 |
| InChI | InChI=1S/C21H19F2N9/c1-9-26-7-11-15(18-28-16(24)13-17(29-18)30-20(25)21(13,2)3)31-32(19(11)27-9)8-10-5-4-6-12(22)14(10)23/h4-7H,8H2,1-3H3,(H4,24,25,28,29,30) |
| InChIKey | RSXSAXJXLBMGJN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |