C19H18Cl2FN5O — CID 123292108
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-yl)pyridin-2-amine (PubChem CID 123292108) has the molecular formula C19H18Cl2FN5O and a molecular weight of 422.29 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-yl)pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 123292108 |
| Molecular Formula | C19H18Cl2FN5O |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cn3c(n2)CNCC3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H18Cl2FN5O/c1-10(17-12(20)2-3-13(22)18(17)21)28-15-6-11(7-25-19(15)23)14-9-27-5-4-24-8-16(27)26-14/h2-3,6-7,9-10,24H,4-5,8H2,1H3,(H2,23,25) |
| InChIKey | RJFCQXWNDRTXQY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|