About 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea
1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea (PubChem CID 123292195) has the molecular formula C14H25N3O3S
and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea.
Molecular Properties
| Compound Name | 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea |
| PubChem CID | 123292195 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea |
| SMILES | COc1ccc(NC(=O)NS(C)(C)C)c(OCCCN)c1 |
| InChI | InChI=1S/C14H25N3O3S/c1-19-11-6-7-12(13(10-11)20-9-5-8-15)16-14(18)17-21(2,3)4/h6-7,10H,5,8-9,15H2,1-4H3,(H2,16,17,18) |
| InChIKey | FYMGDALONZOHMN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea?
The IUPAC name of 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea (CID 123292195) is 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea.
What is the SMILES notation for 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea?
The canonical SMILES for 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea is COc1ccc(NC(=O)NS(C)(C)C)c(OCCCN)c1.
What is the InChIKey of 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea?
The InChIKey is FYMGDALONZOHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3S/c1-19-11-6-7-12(13(10-11)20-9-5-8-15)16-14(18)17-21(2,3)4/h6-7,10H,5,8-9,15H2,1-4H3,(H2,16,17,18).
What are the key properties of 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea?
1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea has a molecular weight of 315.44 g/mol, XLogP of 2.15, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-aminopropoxy)-4-methoxyphenyl]-3-(trimethyl-λ4-sulfanyl)urea is sourced from PubChem (CID 123292195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).