C16H18F6INO2 — CID 123292197
N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-iodophenyl]methyl]but-2-en-1-amine (PubChem CID 123292197) has the molecular formula C16H18F6INO2 and a molecular weight of 497.22 g/mol. Its IUPAC name is N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-iodophenyl]methyl]but-2-en-1-amine.
| Compound Name | N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-iodophenyl]methyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 123292197 |
| Molecular Formula | C16H18F6INO2 |
| Molecular Weight | 497.22 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | N-[[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-4-iodophenyl]methyl]but-2-en-1-amine |
| SMILES | CC=CCNCc1ccc(I)c(C(OCOC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F6INO2/c1-3-4-7-24-9-11-5-6-13(23)12(8-11)14(15(17,18)19,16(20,21)22)26-10-25-2/h3-6,8,24H,7,9-10H2,1-2H3 |
| InChIKey | WTDOINMXKZVGAD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|