About N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide (PubChem CID 123292348) has the molecular formula C18H21F2N3O
and a molecular weight of 333.38 g/mol. Its IUPAC name is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide.
Molecular Properties
| Compound Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide |
| PubChem CID | 123292348 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide |
| SMILES | CC(C)Oc1ccnc(/C(N)=N/Cc2ccc(C(C)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H21F2N3O/c1-12(2)24-15-8-9-22-16(10-15)17(21)23-11-13-4-6-14(7-5-13)18(3,19)20/h4-10,12H,11H2,1-3H3,(H2,21,23) |
| InChIKey | IKRQAEBNZXOVLC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide?
The IUPAC name of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide (CID 123292348) is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide.
What is the SMILES notation for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide?
The canonical SMILES for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide is CC(C)Oc1ccnc(/C(N)=N/Cc2ccc(C(C)(F)F)cc2)c1.
What is the InChIKey of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide?
The InChIKey is IKRQAEBNZXOVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N3O/c1-12(2)24-15-8-9-22-16(10-15)17(21)23-11-13-4-6-14(7-5-13)18(3,19)20/h4-10,12H,11H2,1-3H3,(H2,21,23).
What are the key properties of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide?
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide has a molecular weight of 333.38 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-propan-2-yloxypyridine-2-carboximidamide is sourced from PubChem (CID 123292348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).