About N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine
N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine (PubChem CID 123292891) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine.
Molecular Properties
| Compound Name | N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine |
| PubChem CID | 123292891 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine |
| SMILES | C/N=C(\C)C1=C(C)CCCC=N1 |
| InChI | InChI=1S/C10H16N2/c1-8-6-4-5-7-12-10(8)9(2)11-3/h7H,4-6H2,1-3H3/b11-9+ |
| InChIKey | HWSXXFOOHMNZMS-PKNBQFBNSA-N |
| XLogP | 2.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine?
The IUPAC name of N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine (CID 123292891) is N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine.
What is the SMILES notation for N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine?
The canonical SMILES for N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine is C/N=C(\C)C1=C(C)CCCC=N1.
What is the InChIKey of N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine?
The InChIKey is HWSXXFOOHMNZMS-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H16N2/c1-8-6-4-5-7-12-10(8)9(2)11-3/h7H,4-6H2,1-3H3/b11-9+.
What are the key properties of N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine?
N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine has a molecular weight of 164.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(6-methyl-4,5-dihydro-3H-azepin-7-yl)ethanimine is sourced from PubChem (CID 123292891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).