About 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide
4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide (PubChem CID 123293416) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide |
| PubChem CID | 123293416 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CC(Br)CC=C1C(N)=O |
| InChI | InChI=1S/C8H9BrN2O/c9-5-1-3-6(8(11)12)7(10)4-2-5/h2-5,10H,1H2,(H2,11,12)/b10-7+ |
| InChIKey | GZOQEXWOHOGUBD-JXMROGBWSA-N |
| XLogP | 1.14 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide?
The IUPAC name of 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide (CID 123293416) is 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide.
What is the SMILES notation for 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide?
The canonical SMILES for 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide is [H]/N=C1\C=CC(Br)CC=C1C(N)=O.
What is the InChIKey of 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide?
The InChIKey is GZOQEXWOHOGUBD-JXMROGBWSA-N. The full InChI is InChI=1S/C8H9BrN2O/c9-5-1-3-6(8(11)12)7(10)4-2-5/h2-5,10H,1H2,(H2,11,12)/b10-7+.
What are the key properties of 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide?
4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide has a molecular weight of 229.08 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-iminocyclohepta-1,5-diene-1-carboxamide is sourced from PubChem (CID 123293416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).