C11H13F3N2OS — CID 123293568
(Z)-4-[[[5-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]hex-4-en-3-one (PubChem CID 123293568) has the molecular formula C11H13F3N2OS and a molecular weight of 278.30 g/mol. Its IUPAC name is (Z)-4-[[[5-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]hex-4-en-3-one.
| Compound Name | (Z)-4-[[[5-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]hex-4-en-3-one |
|---|---|
| PubChem CID | 123293568 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (Z)-4-[[[5-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]hex-4-en-3-one |
| SMILES | C/C=C(/CNc1ncc(C(F)(F)F)s1)C(=O)CC |
| InChI | InChI=1S/C11H13F3N2OS/c1-3-7(8(17)4-2)5-15-10-16-6-9(18-10)11(12,13)14/h3,6H,4-5H2,1-2H3,(H,15,16)/b7-3- |
| InChIKey | ULTUHTKKRLUAPX-CLTKARDFSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|