C10H14O — CID 123294094
2-methyl-4-methylidene-5,6,7,7a-tetrahydro-3aH-1-benzofuran (PubChem CID 123294094) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-4-methylidene-5,6,7,7a-tetrahydro-3aH-1-benzofuran.
| Compound Name | 2-methyl-4-methylidene-5,6,7,7a-tetrahydro-3aH-1-benzofuran |
|---|---|
| PubChem CID | 123294094 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-methyl-4-methylidene-5,6,7,7a-tetrahydro-3aH-1-benzofuran |
| SMILES | C=C1CCCC2OC(C)=CC12 |
| InChI | InChI=1S/C10H14O/c1-7-4-3-5-10-9(7)6-8(2)11-10/h6,9-10H,1,3-5H2,2H3 |
| InChIKey | PZEIQKWSJZZLJN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|