C23H28FN7O — CID 123294212
8-(3-fluoro-4-prop-2-enylphenyl)-N-[1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 123294212) has the molecular formula C23H28FN7O and a molecular weight of 437.52 g/mol. Its IUPAC name is 8-(3-fluoro-4-prop-2-enylphenyl)-N-[1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3-fluoro-4-prop-2-enylphenyl)-N-[1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 123294212 |
| Molecular Formula | C23H28FN7O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 8-(3-fluoro-4-prop-2-enylphenyl)-N-[1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C=CCc1ccc(C2CCCn3nc(NC4CCN(c5nnc(C)o5)CC4)nc32)cc1F |
| InChI | InChI=1S/C23H28FN7O/c1-3-5-16-7-8-17(14-20(16)24)19-6-4-11-31-21(19)26-22(29-31)25-18-9-12-30(13-10-18)23-28-27-15(2)32-23/h3,7-8,14,18-19H,1,4-6,9-13H2,2H3,(H,25,29) |
| InChIKey | AUBOSFKMODWZBS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|