C11H22O6 — CID 123294240
(2S,3S,4S,5R)-2,5-bis(hydroxymethyl)-2-pentoxyoxolane-3,4-diol (PubChem CID 123294240) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,5-bis(hydroxymethyl)-2-pentoxyoxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2,5-bis(hydroxymethyl)-2-pentoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 123294240 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2S,3S,4S,5R)-2,5-bis(hydroxymethyl)-2-pentoxyoxolane-3,4-diol |
| SMILES | CCCCCO[C@@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22O6/c1-2-3-4-5-16-11(7-13)10(15)9(14)8(6-12)17-11/h8-10,12-15H,2-7H2,1H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | SNGWVXBFQQWMDJ-ZNSHCXBVSA-N |
| XLogP | -1.01 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|