C8H14N+ — CID 123294262
3-ethyl-1-methyl-2,3-dihydropyridin-1-ium (PubChem CID 123294262) has the molecular formula C8H14N+ and a molecular weight of 124.21 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2,3-dihydropyridin-1-ium.
| Compound Name | 3-ethyl-1-methyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 123294262 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | 3-ethyl-1-methyl-2,3-dihydropyridin-1-ium |
| SMILES | CCC1C=CC=[N+](C)C1 |
| InChI | InChI=1S/C8H14N/c1-3-8-5-4-6-9(2)7-8/h4-6,8H,3,7H2,1-2H3/q+1 |
| InChIKey | GOEUEXJDYLPQEN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|