C30H32N4O3 — CID 123294522
2-[4-[[5-[(6-cyclopropylpyrazin-2-yl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-2-methylpropanoic acid (PubChem CID 123294522) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[4-[[5-[(6-cyclopropylpyrazin-2-yl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[5-[(6-cyclopropylpyrazin-2-yl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 123294522 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[4-[[5-[(6-cyclopropylpyrazin-2-yl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-2-methylpropanoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(C(C)(C)C(=O)O)cc2)c2ccc(C(=O)NCc3cncc(C4CC4)n3)cc12 |
| InChI | InChI=1S/C30H32N4O3/c1-18-19(2)34(17-20-5-10-23(11-6-20)30(3,4)29(36)37)27-12-9-22(13-25(18)27)28(35)32-15-24-14-31-16-26(33-24)21-7-8-21/h5-6,9-14,16,21H,7-8,15,17H2,1-4H3,(H,32,35)(H,36,37) |
| InChIKey | ZEHFXLGVGBLSMO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|