C28H33FNO6+ — CID 123294621
1'-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-1-hydroxypropan-2-yl]-5,5-diphenyl-4-propan-2-ylspiro[1,3-oxazolidin-3-ium-3,4'-2-oxa-4-azoniabicyclo[1.1.0]butane]-2-one (PubChem CID 123294621) has the molecular formula C28H33FNO6+ and a molecular weight of 498.57 g/mol. Its IUPAC name is 1'-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-1-hydroxypropan-2-yl]-5,5-diphenyl-4-propan-2-ylspiro[1,3-oxazolidin-3-ium-3,4'-2-oxa-4-azoniabicyclo[1.1.0]butane]-2-one.
| Compound Name | 1'-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-1-hydroxypropan-2-yl]-5,5-diphenyl-4-propan-2-ylspiro[1,3-oxazolidin-3-ium-3,4'-2-oxa-4-azoniabicyclo[1.1.0]butane]-2-one |
|---|---|
| PubChem CID | 123294621 |
| Molecular Formula | C28H33FNO6+ |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1'-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-1-hydroxypropan-2-yl]-5,5-diphenyl-4-propan-2-ylspiro[1,3-oxazolidin-3-ium-3,4'-2-oxa-4-azoniabicyclo[1.1.0]butane]-2-one |
| SMILES | CC(C)C1C(c2ccccc2)(c2ccccc2)OC(=O)[N+]12C1OC12C(C)(F)C(O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C28H33FNO6/c1-17(2)21-27(18-12-8-6-9-13-18,19-14-10-7-11-15-19)36-24(32)30(21)23-28(30,35-23)26(5,29)22(31)20-16-33-25(3,4)34-20/h6-15,17,20-23,31H,16H2,1-5H3/q+1 |
| InChIKey | QLQYVSCWSXDQEQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|