About 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione
3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione (PubChem CID 123294668) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione.
Molecular Properties
| Compound Name | 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione |
| PubChem CID | 123294668 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione |
| SMILES | COC(C(C)=O)=C(CC(C)CC(CC(C)C)OC)C(C)=O |
| InChI | InChI=1S/C17H30O4/c1-11(2)8-15(20-6)9-12(3)10-16(13(4)18)17(21-7)14(5)19/h11-12,15H,8-10H2,1-7H3 |
| InChIKey | CHEPUXZMWZXKIP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione?
The IUPAC name of 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione (CID 123294668) is 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione.
What is the SMILES notation for 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione?
The canonical SMILES for 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione is COC(C(C)=O)=C(CC(C)CC(CC(C)C)OC)C(C)=O.
What is the InChIKey of 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione?
The InChIKey is CHEPUXZMWZXKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4/c1-11(2)8-15(20-6)9-12(3)10-16(13(4)18)17(21-7)14(5)19/h11-12,15H,8-10H2,1-7H3.
What are the key properties of 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione?
3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione has a molecular weight of 298.42 g/mol, XLogP of 3.54, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(4-methoxy-2,6-dimethylheptyl)hex-3-ene-2,5-dione is sourced from PubChem (CID 123294668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).